C13H14O6 — CID 146681505
(E)-3-(3,5-diacetyl-4,5-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid (PubChem CID 146681505) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is (E)-3-(3,5-diacetyl-4,5-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(3,5-diacetyl-4,5-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 146681505 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (E)-3-(3,5-diacetyl-4,5-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid |
| SMILES | CC(=O)C1=C(O)C(O)(C(C)=O)CC(/C=C/C(=O)O)=C1 |
| InChI | InChI=1S/C13H14O6/c1-7(14)10-5-9(3-4-11(16)17)6-13(19,8(2)15)12(10)18/h3-5,18-19H,6H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | FQDBSYIEGJAWEL-ONEGZZNKSA-N |
| XLogP | 0.68 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|