C24H34ClN3O4S — CID 67587382
[(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(azepan-1-yl)piperidine-1-carboxylate (PubChem CID 67587382) has the molecular formula C24H34ClN3O4S and a molecular weight of 496.07 g/mol. Its IUPAC name is [(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(azepan-1-yl)piperidine-1-carboxylate.
| Compound Name | [(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(azepan-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67587382 |
| Molecular Formula | C24H34ClN3O4S |
| Molecular Weight | 496.07 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(azepan-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(OC[C@H]1CCC[C@H]2c3cc(Cl)ccc3S(=O)(=O)N12)N1CCC(N2CCCCCC2)CC1 |
| InChI | InChI=1S/C24H34ClN3O4S/c25-18-8-9-23-21(16-18)22-7-5-6-20(28(22)33(23,30)31)17-32-24(29)27-14-10-19(11-15-27)26-12-3-1-2-4-13-26/h8-9,16,19-20,22H,1-7,10-15,17H2/t20-,22+/m1/s1 |
| InChIKey | VENDHEZXWRQPRI-IRLDBZIGSA-N |
| XLogP | 4.41 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.07 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |