C20H21N2O5P — CID 67588194
[3-(5-hydroxy-1H-indol-3-yl)-2-[(5-hydroxy-1H-indol-3-yl)methyl]propyl]phosphonic acid (PubChem CID 67588194) has the molecular formula C20H21N2O5P and a molecular weight of 400.37 g/mol. Its IUPAC name is [3-(5-hydroxy-1H-indol-3-yl)-2-[(5-hydroxy-1H-indol-3-yl)methyl]propyl]phosphonic acid.
| Compound Name | [3-(5-hydroxy-1H-indol-3-yl)-2-[(5-hydroxy-1H-indol-3-yl)methyl]propyl]phosphonic acid |
|---|---|
| PubChem CID | 67588194 |
| Molecular Formula | C20H21N2O5P |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [3-(5-hydroxy-1H-indol-3-yl)-2-[(5-hydroxy-1H-indol-3-yl)methyl]propyl]phosphonic acid |
| SMILES | O=P(O)(O)CC(Cc1c[nH]c2ccc(O)cc12)Cc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C20H21N2O5P/c23-15-1-3-19-17(7-15)13(9-21-19)5-12(11-28(25,26)27)6-14-10-22-20-4-2-16(24)8-18(14)20/h1-4,7-10,12,21-24H,5-6,11H2,(H2,25,26,27) |
| InChIKey | XNUNMEQVWXVOAJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|