C27H31N3O5 — CID 67589119
2-[[1-amino-3-(4-naphthalen-1-ylphenyl)-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid (PubChem CID 67589119) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-[[1-amino-3-(4-naphthalen-1-ylphenyl)-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid.
| Compound Name | 2-[[1-amino-3-(4-naphthalen-1-ylphenyl)-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67589119 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 2-[[1-amino-3-(4-naphthalen-1-ylphenyl)-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid |
| SMILES | CC(C)CN(C(=O)NC(Cc1ccc(-c2cccc3ccccc23)cc1)C(N)=O)C(C)(O)C(=O)O |
| InChI | InChI=1S/C27H31N3O5/c1-17(2)16-30(27(3,35)25(32)33)26(34)29-23(24(28)31)15-18-11-13-20(14-12-18)22-10-6-8-19-7-4-5-9-21(19)22/h4-14,17,23,35H,15-16H2,1-3H3,(H2,28,31)(H,29,34)(H,32,33) |
| InChIKey | GXVPPLFUIQWBKD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|