C21H27N3O5 — CID 70258193
(2S)-2-[[(2S)-1-amino-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid (PubChem CID 70258193) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-amino-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-amino-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 70258193 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (2S)-2-[[(2S)-1-amino-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamoyl-(2-methylpropyl)amino]-2-hydroxypropanoic acid |
| SMILES | CC(C)CN(C(=O)N[C@@H](Cc1cccc2ccccc12)C(N)=O)[C@@](C)(O)C(=O)O |
| InChI | InChI=1S/C21H27N3O5/c1-13(2)12-24(21(3,29)19(26)27)20(28)23-17(18(22)25)11-15-9-6-8-14-7-4-5-10-16(14)15/h4-10,13,17,29H,11-12H2,1-3H3,(H2,22,25)(H,23,28)(H,26,27)/t17-,21-/m0/s1 |
| InChIKey | PALNFWPDZJVIFO-UWJYYQICSA-N |
| XLogP | 1.70 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|