C27H29N5O3 — CID 67592607
3-[2-[1,2-bis(methylamino)propyl]-1H-indol-3-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 67592607) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 3-[2-[1,2-bis(methylamino)propyl]-1H-indol-3-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-[1,2-bis(methylamino)propyl]-1H-indol-3-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67592607 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 3-[2-[1,2-bis(methylamino)propyl]-1H-indol-3-yl]-4-(5-methoxy-1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | CNC(C)C(NC)c1[nH]c2ccccc2c1C1=C(c2cn(C)c3ccc(OC)cc23)C(=O)NC1=O |
| InChI | InChI=1S/C27H29N5O3/c1-14(28-2)24(29-3)25-21(16-8-6-7-9-19(16)30-25)23-22(26(33)31-27(23)34)18-13-32(4)20-11-10-15(35-5)12-17(18)20/h6-14,24,28-30H,1-5H3,(H,31,33,34) |
| InChIKey | MAVUJRULPFQQFF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|