C19H17N5O3 — CID 67598186
2-[4-[4-(tetrazol-1-yl)phenoxy]butyl]isoindole-1,3-dione (PubChem CID 67598186) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is 2-[4-[4-(tetrazol-1-yl)phenoxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(tetrazol-1-yl)phenoxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67598186 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[4-[4-(tetrazol-1-yl)phenoxy]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCOc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C19H17N5O3/c25-18-16-5-1-2-6-17(16)19(26)23(18)11-3-4-12-27-15-9-7-14(8-10-15)24-13-20-21-22-24/h1-2,5-10,13H,3-4,11-12H2 |
| InChIKey | YZPZBHSQQBUGCJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|