C25H28ClN5O2 — CID 67599421
N-[4-(6-chloro-2,3-dihydro-1H-indol-3-yl)-7-[4-(dimethylamino)butoxy]quinazolin-6-yl]prop-2-enamide (PubChem CID 67599421) has the molecular formula C25H28ClN5O2 and a molecular weight of 465.99 g/mol. Its IUPAC name is N-[4-(6-chloro-2,3-dihydro-1H-indol-3-yl)-7-[4-(dimethylamino)butoxy]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(6-chloro-2,3-dihydro-1H-indol-3-yl)-7-[4-(dimethylamino)butoxy]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67599421 |
| Molecular Formula | C25H28ClN5O2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[4-(6-chloro-2,3-dihydro-1H-indol-3-yl)-7-[4-(dimethylamino)butoxy]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(C3CNc4cc(Cl)ccc43)ncnc2cc1OCCCCN(C)C |
| InChI | InChI=1S/C25H28ClN5O2/c1-4-24(32)30-22-12-18-21(13-23(22)33-10-6-5-9-31(2)3)28-15-29-25(18)19-14-27-20-11-16(26)7-8-17(19)20/h4,7-8,11-13,15,19,27H,1,5-6,9-10,14H2,2-3H3,(H,30,32) |
| InChIKey | SGNGLMCHIGFNRJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|