C27H29F2N8O+ — CID 67600770
2-[[4-[[4-anilino-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]-2-fluorobenzoyl]amino]ethyl-trimethylazanium (PubChem CID 67600770) has the molecular formula C27H29F2N8O+ and a molecular weight of 519.58 g/mol. Its IUPAC name is 2-[[4-[[4-anilino-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]-2-fluorobenzoyl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[4-[[4-anilino-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]-2-fluorobenzoyl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 67600770 |
| Molecular Formula | C27H29F2N8O+ |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 2-[[4-[[4-anilino-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]-2-fluorobenzoyl]amino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNC(=O)c1ccc(Nc2nc(Nc3ccccc3)nc(Nc3cccc(F)c3)n2)cc1F |
| InChI | InChI=1S/C27H28F2N8O/c1-37(2,3)15-14-30-24(38)22-13-12-21(17-23(22)29)33-27-35-25(31-19-9-5-4-6-10-19)34-26(36-27)32-20-11-7-8-18(28)16-20/h4-13,16-17H,14-15H2,1-3H3,(H3-,30,31,32,33,34,35,36,38)/p+1 |
| InChIKey | JARNNCREMNIOJL-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|