C21H21N3O3 — CID 67609594
3-[(3aR,9S,9aR)-2'-amino-3a-methylspiro[3,4a,5,9a-tetrahydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-7-yl]benzonitrile (PubChem CID 67609594) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[(3aR,9S,9aR)-2'-amino-3a-methylspiro[3,4a,5,9a-tetrahydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-7-yl]benzonitrile.
| Compound Name | 3-[(3aR,9S,9aR)-2'-amino-3a-methylspiro[3,4a,5,9a-tetrahydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-7-yl]benzonitrile |
|---|---|
| PubChem CID | 67609594 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-[(3aR,9S,9aR)-2'-amino-3a-methylspiro[3,4a,5,9a-tetrahydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-7-yl]benzonitrile |
| SMILES | C[C@@]12CCO[C@@H]1[C@@]1(COC(N)=N1)C1=CC(c3cccc(C#N)c3)=CCC1O2 |
| InChI | InChI=1S/C21H21N3O3/c1-20-7-8-25-18(20)21(12-26-19(23)24-21)16-10-15(5-6-17(16)27-20)14-4-2-3-13(9-14)11-22/h2-5,9-10,17-18H,6-8,12H2,1H3,(H2,23,24)/t17?,18-,20+,21+/m0/s1 |
| InChIKey | XPQROVJOBCFEKK-LSMWDBJESA-N |
| XLogP | 2.30 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |