C6H6Cl2N2O — CID 676127
2,5-dichloro-4-methoxypyridin-3-amine (PubChem CID 676127) has the molecular formula C6H6Cl2N2O and a molecular weight of 193.03 g/mol. Its IUPAC name is 2,5-dichloro-4-methoxypyridin-3-amine.
| Compound Name | 2,5-dichloro-4-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 676127 |
| Molecular Formula | C6H6Cl2N2O |
| Molecular Weight | 193.03 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | 2,5-dichloro-4-methoxypyridin-3-amine |
| SMILES | COc1c(Cl)cnc(Cl)c1N |
| InChI | InChI=1S/C6H6Cl2N2O/c1-11-5-3(7)2-10-6(8)4(5)9/h2H,9H2,1H3 |
| InChIKey | WCBPZKWSMYMBMD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.03 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|