C24H34N2O5S — CID 67616235
[(4S)-3-hydroxy-4-[3-methylbutyl(methylsulfonyl)amino]-4-phenylbutyl] N-benzylcarbamate (PubChem CID 67616235) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is [(4S)-3-hydroxy-4-[3-methylbutyl(methylsulfonyl)amino]-4-phenylbutyl] N-benzylcarbamate.
| Compound Name | [(4S)-3-hydroxy-4-[3-methylbutyl(methylsulfonyl)amino]-4-phenylbutyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 67616235 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [(4S)-3-hydroxy-4-[3-methylbutyl(methylsulfonyl)amino]-4-phenylbutyl] N-benzylcarbamate |
| SMILES | CC(C)CCN([C@@H](c1ccccc1)C(O)CCOC(=O)NCc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H34N2O5S/c1-19(2)14-16-26(32(3,29)30)23(21-12-8-5-9-13-21)22(27)15-17-31-24(28)25-18-20-10-6-4-7-11-20/h4-13,19,22-23,27H,14-18H2,1-3H3,(H,25,28)/t22?,23-/m0/s1 |
| InChIKey | RLVPIRCKNBDZQM-WCSIJFPASA-N |
| XLogP | 3.71 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |