C39H42ClN3O7S — CID 67620551
[3-(2,1,3-benzothiadiazol-5-yl)-5-methoxy-1-[(2-methoxyphenyl)methyl]-6-pentoxyindol-2-yl] ethyl carbonate;1-(chloromethyl)-2-methoxybenzene (PubChem CID 67620551) has the molecular formula C39H42ClN3O7S and a molecular weight of 732.30 g/mol. Its IUPAC name is [3-(2,1,3-benzothiadiazol-5-yl)-5-methoxy-1-[(2-methoxyphenyl)methyl]-6-pentoxyindol-2-yl] ethyl carbonate;1-(chloromethyl)-2-methoxybenzene.
| Compound Name | [3-(2,1,3-benzothiadiazol-5-yl)-5-methoxy-1-[(2-methoxyphenyl)methyl]-6-pentoxyindol-2-yl] ethyl carbonate;1-(chloromethyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 67620551 |
| Molecular Formula | C39H42ClN3O7S |
| Molecular Weight | 732.30 g/mol |
| Exact Mass | 731.24 |
| IUPAC Name | [3-(2,1,3-benzothiadiazol-5-yl)-5-methoxy-1-[(2-methoxyphenyl)methyl]-6-pentoxyindol-2-yl] ethyl carbonate;1-(chloromethyl)-2-methoxybenzene |
| SMILES | CCCCCOc1cc2c(cc1OC)c(-c1ccc3nsnc3c1)c(OC(=O)OCC)n2Cc1ccccc1OC.COc1ccccc1CCl |
| InChI | InChI=1S/C31H33N3O6S.C8H9ClO/c1-5-7-10-15-39-28-18-25-22(17-27(28)37-4)29(20-13-14-23-24(16-20)33-41-32-23)30(40-31(35)38-6-2)34(25)19-21-11-8-9-12-26(21)36-3;1-10-8-5-3-2-4-7(8)6-9/h8-9,11-14,16-18H,5-7,10,15,19H2,1-4H3;2-5H,6H2,1H3 |
| InChIKey | OHNJXYMVELVJGX-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 103.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.30 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|