C21H18ClNO5S — CID 67621095
2-[3-[(2-benzylphenyl)sulfonylamino]-5-chlorophenoxy]acetic acid (PubChem CID 67621095) has the molecular formula C21H18ClNO5S and a molecular weight of 431.90 g/mol. Its IUPAC name is 2-[3-[(2-benzylphenyl)sulfonylamino]-5-chlorophenoxy]acetic acid.
| Compound Name | 2-[3-[(2-benzylphenyl)sulfonylamino]-5-chlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 67621095 |
| Molecular Formula | C21H18ClNO5S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-[3-[(2-benzylphenyl)sulfonylamino]-5-chlorophenoxy]acetic acid |
| SMILES | O=C(O)COc1cc(Cl)cc(NS(=O)(=O)c2ccccc2Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H18ClNO5S/c22-17-11-18(13-19(12-17)28-14-21(24)25)23-29(26,27)20-9-5-4-8-16(20)10-15-6-2-1-3-7-15/h1-9,11-13,23H,10,14H2,(H,24,25) |
| InChIKey | ZWYQLASGVVSDIK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |