C17H17ClO5 — CID 67625793
4-(4-chlorophenyl)-2,6-diethyl-4H-pyran-3,5-dicarboxylic acid (PubChem CID 67625793) has the molecular formula C17H17ClO5 and a molecular weight of 336.77 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,6-diethyl-4H-pyran-3,5-dicarboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2,6-diethyl-4H-pyran-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67625793 |
| Molecular Formula | C17H17ClO5 |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-(4-chlorophenyl)-2,6-diethyl-4H-pyran-3,5-dicarboxylic acid |
| SMILES | CCC1=C(C(=O)O)C(c2ccc(Cl)cc2)C(C(=O)O)=C(CC)O1 |
| InChI | InChI=1S/C17H17ClO5/c1-3-11-14(16(19)20)13(9-5-7-10(18)8-6-9)15(17(21)22)12(4-2)23-11/h5-8,13H,3-4H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | CXUQRDZRZWWBDZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |