C16H18N4 — CID 67626100
6-(1,4-diazepan-1-yl)pyrrolo[1,2-a]quinoxaline (PubChem CID 67626100) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-yl)pyrrolo[1,2-a]quinoxaline.
| Compound Name | 6-(1,4-diazepan-1-yl)pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 67626100 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 6-(1,4-diazepan-1-yl)pyrrolo[1,2-a]quinoxaline |
| SMILES | c1cc(N2CCCNCC2)c2ncc3cccn3c2c1 |
| InChI | InChI=1S/C16H18N4/c1-5-14(19-9-3-7-17-8-11-19)16-15(6-1)20-10-2-4-13(20)12-18-16/h1-2,4-6,10,12,17H,3,7-9,11H2 |
| InChIKey | LTZQOMOHKOKZCG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |