C43H45N5O3 — CID 67631754
3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-(2-phenylethyl)urea (PubChem CID 67631754) has the molecular formula C43H45N5O3 and a molecular weight of 679.87 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-(2-phenylethyl)urea.
| Compound Name | 3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 67631754 |
| Molecular Formula | C43H45N5O3 |
| Molecular Weight | 679.87 g/mol |
| Exact Mass | 679.35 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-(2-phenylethyl)urea |
| SMILES | CC(C)c1cc(-c2cccc(OCCCc3ccncc3)c2)cc(C(C)C)c1NC(=O)N(CCc1ccccc1)c1cc2cccnc2[nH]c1=O |
| InChI | InChI=1S/C43H45N5O3/c1-29(2)37-26-35(33-14-8-16-36(25-33)51-24-10-13-32-17-21-44-22-18-32)27-38(30(3)4)40(37)46-43(50)48(23-19-31-11-6-5-7-12-31)39-28-34-15-9-20-45-41(34)47-42(39)49/h5-9,11-12,14-18,20-22,25-30H,10,13,19,23-24H2,1-4H3,(H,46,50)(H,45,47,49) |
| InChIKey | RYDFKVJZMVWLQJ-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.87 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|