C42H43N5O3 — CID 67633055
1-benzyl-3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea (PubChem CID 67633055) has the molecular formula C42H43N5O3 and a molecular weight of 665.84 g/mol. Its IUPAC name is 1-benzyl-3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea.
| Compound Name | 1-benzyl-3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea |
|---|---|
| PubChem CID | 67633055 |
| Molecular Formula | C42H43N5O3 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.34 |
| IUPAC Name | 1-benzyl-3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-4-ylpropoxy)phenyl]phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea |
| SMILES | CC(C)c1cc(-c2cccc(OCCCc3ccncc3)c2)cc(C(C)C)c1NC(=O)N(Cc1ccccc1)c1cc2cccnc2[nH]c1=O |
| InChI | InChI=1S/C42H43N5O3/c1-28(2)36-24-34(32-14-8-16-35(23-32)50-22-10-13-30-17-20-43-21-18-30)25-37(29(3)4)39(36)45-42(49)47(27-31-11-6-5-7-12-31)38-26-33-15-9-19-44-40(33)46-41(38)48/h5-9,11-12,14-21,23-26,28-29H,10,13,22,27H2,1-4H3,(H,45,49)(H,44,46,48) |
| InChIKey | TVKRRVCQUADQQD-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|