[(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid

C6H10N2O2 — CID 67632983

IUPAC[(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid
SMILESN[C@H]1C=C[C@@H](NC(=O)O)C1
InChIInChI=1S/C6H10N2O2/c7-4-1-2-5(3-4)8-6(9)10/h1-2,4-5,8H,3,7H2,(H,9,10)/t4-,5+/m0/s1
InChIKeyRSJCVGWUKXOPCQ-CRCLSJGQSA-N
MW142.16 g/mol
LogP-0.09
Rot. Bonds1

About [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid

[(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid (PubChem CID 67632983) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid.

Molecular Properties

Compound Name[(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid
PubChem CID67632983
Molecular FormulaC6H10N2O2
Molecular Weight142.16 g/mol
Exact Mass142.07
IUPAC Name[(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid
SMILESN[C@H]1C=C[C@@H](NC(=O)O)C1
InChIInChI=1S/C6H10N2O2/c7-4-1-2-5(3-4)8-6(9)10/h1-2,4-5,8H,3,7H2,(H,9,10)/t4-,5+/m0/s1
InChIKeyRSJCVGWUKXOPCQ-CRCLSJGQSA-N
XLogP-0.09
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.16
LogP ≤ 5-0.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid?
The IUPAC name of [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid (CID 67632983) is [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid.
What is the SMILES notation for [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid?
The canonical SMILES for [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid is N[C@H]1C=C[C@@H](NC(=O)O)C1.
What is the InChIKey of [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid?
The InChIKey is RSJCVGWUKXOPCQ-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H10N2O2/c7-4-1-2-5(3-4)8-6(9)10/h1-2,4-5,8H,3,7H2,(H,9,10)/t4-,5+/m0/s1.
What are the key properties of [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid?
[(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid has a molecular weight of 142.16 g/mol, XLogP of -0.09, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4R)-4-aminocyclopent-2-en-1-yl]carbamic acid is sourced from PubChem (CID 67632983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).