C20H28O8 — CID 67633868
[4-methoxy-3-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl] cyclohexanecarboxylate (PubChem CID 67633868) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is [4-methoxy-3-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl] cyclohexanecarboxylate.
| Compound Name | [4-methoxy-3-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 67633868 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [4-methoxy-3-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl] cyclohexanecarboxylate |
| SMILES | COc1ccc(OC(=O)C2CCCCC2)cc1[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H28O8/c1-26-14-8-7-12(27-20(25)11-5-3-2-4-6-11)9-13(14)19-18(24)17(23)16(22)15(10-21)28-19/h7-9,11,15-19,21-24H,2-6,10H2,1H3/t15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | XYWAPQQMKOMVAS-SPOLIRPYSA-N |
| XLogP | 0.70 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|