C28H33NO5S — CID 67637604
4-[(2-cyclohexyl-2-phenylethyl)sulfonylamino]-2-naphthalen-1-yloxybutanoic acid (PubChem CID 67637604) has the molecular formula C28H33NO5S and a molecular weight of 495.64 g/mol. Its IUPAC name is 4-[(2-cyclohexyl-2-phenylethyl)sulfonylamino]-2-naphthalen-1-yloxybutanoic acid.
| Compound Name | 4-[(2-cyclohexyl-2-phenylethyl)sulfonylamino]-2-naphthalen-1-yloxybutanoic acid |
|---|---|
| PubChem CID | 67637604 |
| Molecular Formula | C28H33NO5S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 4-[(2-cyclohexyl-2-phenylethyl)sulfonylamino]-2-naphthalen-1-yloxybutanoic acid |
| SMILES | O=C(O)C(CCNS(=O)(=O)CC(c1ccccc1)C1CCCCC1)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C28H33NO5S/c30-28(31)27(34-26-17-9-15-21-14-7-8-16-24(21)26)18-19-29-35(32,33)20-25(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1,3-4,7-11,14-17,23,25,27,29H,2,5-6,12-13,18-20H2,(H,30,31) |
| InChIKey | OHYKNMNASHYWRN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |