C25H29NO5 — CID 67638479
4-[3-amino-4-(3,4-dimethoxyphenyl)-2-hydroxy-5-phenylpentoxy]phenol (PubChem CID 67638479) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 4-[3-amino-4-(3,4-dimethoxyphenyl)-2-hydroxy-5-phenylpentoxy]phenol.
| Compound Name | 4-[3-amino-4-(3,4-dimethoxyphenyl)-2-hydroxy-5-phenylpentoxy]phenol |
|---|---|
| PubChem CID | 67638479 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-[3-amino-4-(3,4-dimethoxyphenyl)-2-hydroxy-5-phenylpentoxy]phenol |
| SMILES | COc1ccc(C(Cc2ccccc2)C(N)C(O)COc2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C25H29NO5/c1-29-23-13-8-18(15-24(23)30-2)21(14-17-6-4-3-5-7-17)25(26)22(28)16-31-20-11-9-19(27)10-12-20/h3-13,15,21-22,25,27-28H,14,16,26H2,1-2H3 |
| InChIKey | UHKCLAYTDNKOER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |