C15H26N2O — CID 67642420
(1R)-3-(1,2-oxazol-5-yl)-N,N-dipropylcyclohexan-1-amine (PubChem CID 67642420) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (1R)-3-(1,2-oxazol-5-yl)-N,N-dipropylcyclohexan-1-amine.
| Compound Name | (1R)-3-(1,2-oxazol-5-yl)-N,N-dipropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 67642420 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (1R)-3-(1,2-oxazol-5-yl)-N,N-dipropylcyclohexan-1-amine |
| SMILES | CCCN(CCC)[C@@H]1CCCC(c2ccno2)C1 |
| InChI | InChI=1S/C15H26N2O/c1-3-10-17(11-4-2)14-7-5-6-13(12-14)15-8-9-16-18-15/h8-9,13-14H,3-7,10-12H2,1-2H3/t13?,14-/m1/s1 |
| InChIKey | YYIMGTMGSTVYBU-ARLHGKGLSA-N |
| XLogP | 3.82 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |