C19H30N2O6 — CID 67642605
6-(2,3-dimethoxyphenyl)-4-N-propylhex-2-ene-1,4-diamine;oxalic acid (PubChem CID 67642605) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is 6-(2,3-dimethoxyphenyl)-4-N-propylhex-2-ene-1,4-diamine;oxalic acid.
| Compound Name | 6-(2,3-dimethoxyphenyl)-4-N-propylhex-2-ene-1,4-diamine;oxalic acid |
|---|---|
| PubChem CID | 67642605 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 6-(2,3-dimethoxyphenyl)-4-N-propylhex-2-ene-1,4-diamine;oxalic acid |
| SMILES | CCCNC(C=CCN)CCc1cccc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H28N2O2.C2H2O4/c1-4-13-19-15(8-6-12-18)11-10-14-7-5-9-16(20-2)17(14)21-3;3-1(4)2(5)6/h5-9,15,19H,4,10-13,18H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | KVOKARWKKUMPQE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|