C28H33BrO3 — CID 67643183
(6R,8R,9R,10R,11S,13S,14S,17S)-6-bromo-17-hydroxy-11-(4-methoxyphenyl)-13-methyl-17-prop-1-ynyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67643183) has the molecular formula C28H33BrO3 and a molecular weight of 497.47 g/mol. Its IUPAC name is (6R,8R,9R,10R,11S,13S,14S,17S)-6-bromo-17-hydroxy-11-(4-methoxyphenyl)-13-methyl-17-prop-1-ynyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6R,8R,9R,10R,11S,13S,14S,17S)-6-bromo-17-hydroxy-11-(4-methoxyphenyl)-13-methyl-17-prop-1-ynyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67643183 |
| Molecular Formula | C28H33BrO3 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (6R,8R,9R,10R,11S,13S,14S,17S)-6-bromo-17-hydroxy-11-(4-methoxyphenyl)-13-methyl-17-prop-1-ynyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3C[C@@H](Br)C4=CC(=O)CC[C@@H]4[C@H]3[C@@H](c3ccc(OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C28H33BrO3/c1-4-12-28(31)13-11-24-22-15-25(29)21-14-18(30)7-10-20(21)26(22)23(16-27(24,28)2)17-5-8-19(32-3)9-6-17/h5-6,8-9,14,20,22-26,31H,7,10-11,13,15-16H2,1-3H3/t20-,22-,23+,24-,25+,26+,27-,28-/m0/s1 |
| InChIKey | WDSNGKCQTMWERC-RFHQXFPXSA-N |
| XLogP | 5.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|