C16H16N2O4S — CID 67645206
3-hydroxy-2,2-dimethyl-N-pyridin-2-ylchromene-6-sulfonamide (PubChem CID 67645206) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-N-pyridin-2-ylchromene-6-sulfonamide.
| Compound Name | 3-hydroxy-2,2-dimethyl-N-pyridin-2-ylchromene-6-sulfonamide |
|---|---|
| PubChem CID | 67645206 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-N-pyridin-2-ylchromene-6-sulfonamide |
| SMILES | CC1(C)Oc2ccc(S(=O)(=O)Nc3ccccn3)cc2C=C1O |
| InChI | InChI=1S/C16H16N2O4S/c1-16(2)14(19)10-11-9-12(6-7-13(11)22-16)23(20,21)18-15-5-3-4-8-17-15/h3-10,19H,1-2H3,(H,17,18) |
| InChIKey | YKUGIBZDZNZCNA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |