C22H27N3O3 — CID 67647279
1-phenoxy-2-(4-pyridin-2-ylpiperazin-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 67647279) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-phenoxy-2-(4-pyridin-2-ylpiperazin-1-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-phenoxy-2-(4-pyridin-2-ylpiperazin-1-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67647279 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-phenoxy-2-(4-pyridin-2-ylpiperazin-1-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(Oc2ccccc2)CCCCC1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H27N3O3/c26-21(27)22(28-18-8-2-1-3-9-18)12-6-4-10-19(22)24-14-16-25(17-15-24)20-11-5-7-13-23-20/h1-3,5,7-9,11,13,19H,4,6,10,12,14-17H2,(H,26,27) |
| InChIKey | GORYHCWVUOZFLC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |