C18H21O2P — CID 67647859
1,3,5-trimethyl-2-[[2-(1-phosphorosooxyethyl)phenyl]methyl]benzene (PubChem CID 67647859) has the molecular formula C18H21O2P and a molecular weight of 300.34 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[[2-(1-phosphorosooxyethyl)phenyl]methyl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[[2-(1-phosphorosooxyethyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 67647859 |
| Molecular Formula | C18H21O2P |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1,3,5-trimethyl-2-[[2-(1-phosphorosooxyethyl)phenyl]methyl]benzene |
| SMILES | Cc1cc(C)c(Cc2ccccc2C(C)OP=O)c(C)c1 |
| InChI | InChI=1S/C18H21O2P/c1-12-9-13(2)18(14(3)10-12)11-16-7-5-6-8-17(16)15(4)20-21-19/h5-10,15H,11H2,1-4H3 |
| InChIKey | ZBHHMMVIJODGND-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|