C20H27BrN2O3S — CID 67648076
N-[2-[[4-[3-(2-bromophenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide (PubChem CID 67648076) has the molecular formula C20H27BrN2O3S and a molecular weight of 455.42 g/mol. Its IUPAC name is N-[2-[[4-[3-(2-bromophenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide.
| Compound Name | N-[2-[[4-[3-(2-bromophenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 67648076 |
| Molecular Formula | C20H27BrN2O3S |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[2-[[4-[3-(2-bromophenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide |
| SMILES | CC(CNS(C)(=O)=O)NCc1ccc(OCCCc2ccccc2Br)cc1 |
| InChI | InChI=1S/C20H27BrN2O3S/c1-16(14-23-27(2,24)25)22-15-17-9-11-19(12-10-17)26-13-5-7-18-6-3-4-8-20(18)21/h3-4,6,8-12,16,22-23H,5,7,13-15H2,1-2H3 |
| InChIKey | RWBMVZCYXKPUMS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|