C21H30N2O4S — CID 67782256
N-[2-[[4-[3-(3-methoxyphenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide (PubChem CID 67782256) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[2-[[4-[3-(3-methoxyphenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide.
| Compound Name | N-[2-[[4-[3-(3-methoxyphenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 67782256 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[2-[[4-[3-(3-methoxyphenyl)propoxy]phenyl]methylamino]propyl]methanesulfonamide |
| SMILES | COc1cccc(CCCOc2ccc(CNC(C)CNS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C21H30N2O4S/c1-17(15-23-28(3,24)25)22-16-19-9-11-20(12-10-19)27-13-5-7-18-6-4-8-21(14-18)26-2/h4,6,8-12,14,17,22-23H,5,7,13,15-16H2,1-3H3 |
| InChIKey | RNZBGFVERABOAT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|