C20H28N2O4S — CID 70001483
N-[3-hydroxy-2-[[4-(3-phenylpropoxy)phenyl]methylamino]propyl]methanesulfonamide (PubChem CID 70001483) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[3-hydroxy-2-[[4-(3-phenylpropoxy)phenyl]methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-hydroxy-2-[[4-(3-phenylpropoxy)phenyl]methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 70001483 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[3-hydroxy-2-[[4-(3-phenylpropoxy)phenyl]methylamino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC(CO)NCc1ccc(OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H28N2O4S/c1-27(24,25)22-15-19(16-23)21-14-18-9-11-20(12-10-18)26-13-5-8-17-6-3-2-4-7-17/h2-4,6-7,9-12,19,21-23H,5,8,13-16H2,1H3 |
| InChIKey | HXYNDQKMUPXODH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|