C18H20N2O5 — CID 67650306
[3-[(2-cyanoacetyl)amino]phenyl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 67650306) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is [3-[(2-cyanoacetyl)amino]phenyl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | [3-[(2-cyanoacetyl)amino]phenyl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67650306 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [3-[(2-cyanoacetyl)amino]phenyl] 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)Oc1cccc(NC(=O)CC#N)c1 |
| InChI | InChI=1S/C13H12N2O3.C5H8O2/c1-9(2)13(17)18-11-5-3-4-10(8-11)15-12(16)6-7-14;1-4(2)5(6)7-3/h3-5,8H,1,6H2,2H3,(H,15,16);1H2,2-3H3 |
| InChIKey | GFSQBLADKCRLFR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|