C17H17F3N2O3S — CID 67651757
(Z)-3-cyclopropyl-3-(dimethylamino)-2-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]prop-2-enenitrile (PubChem CID 67651757) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-3-(dimethylamino)-2-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]prop-2-enenitrile.
| Compound Name | (Z)-3-cyclopropyl-3-(dimethylamino)-2-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 67651757 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (Z)-3-cyclopropyl-3-(dimethylamino)-2-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]prop-2-enenitrile |
| SMILES | CN(C)/C(=C(/C#N)C(=O)c1ccc(C(F)(F)F)cc1S(C)(=O)=O)C1CC1 |
| InChI | InChI=1S/C17H17F3N2O3S/c1-22(2)15(10-4-5-10)13(9-21)16(23)12-7-6-11(17(18,19)20)8-14(12)26(3,24)25/h6-8,10H,4-5H2,1-3H3/b15-13- |
| InChIKey | XZXRUWTVUOUOBM-SQFISAMPSA-N |
| XLogP | 3.04 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|