About (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine
(5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine (PubChem CID 67655096) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine.
Molecular Properties
| Compound Name | (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine |
| PubChem CID | 67655096 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine |
| SMILES | CC1C(c2cccc(F)c2)OC[C@H](C)N1C |
| InChI | InChI=1S/C13H18FNO/c1-9-8-16-13(10(2)15(9)3)11-5-4-6-12(14)7-11/h4-7,9-10,13H,8H2,1-3H3/t9-,10?,13?/m0/s1 |
| InChIKey | WFPZWMWWDUBDBQ-JBLZRFIASA-N |
| XLogP | 2.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine?
The IUPAC name of (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine (CID 67655096) is (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine.
What is the SMILES notation for (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine?
The canonical SMILES for (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine is CC1C(c2cccc(F)c2)OC[C@H](C)N1C.
What is the InChIKey of (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine?
The InChIKey is WFPZWMWWDUBDBQ-JBLZRFIASA-N. The full InChI is InChI=1S/C13H18FNO/c1-9-8-16-13(10(2)15(9)3)11-5-4-6-12(14)7-11/h4-7,9-10,13H,8H2,1-3H3/t9-,10?,13?/m0/s1.
What are the key properties of (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine?
(5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine has a molecular weight of 223.29 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-(3-fluorophenyl)-3,4,5-trimethylmorpholine is sourced from PubChem (CID 67655096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).