C14H21IN2O2 — CID 67657979
1-[4-(2-iodoethylideneamino)phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 67657979) has the molecular formula C14H21IN2O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 1-[4-(2-iodoethylideneamino)phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[4-(2-iodoethylideneamino)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 67657979 |
| Molecular Formula | C14H21IN2O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-[4-(2-iodoethylideneamino)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1ccc(/N=C/CI)cc1 |
| InChI | InChI=1S/C14H21IN2O2/c1-11(2)17-9-13(18)10-19-14-5-3-12(4-6-14)16-8-7-15/h3-6,8,11,13,17-18H,7,9-10H2,1-2H3/b16-8+ |
| InChIKey | AGFGTVLFPZXRBE-LZYBPNLTSA-N |
| XLogP | 2.56 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|