C28H26O4 — CID 67659199
3-(6-methoxy-2-phenylmethoxynaphthalen-1-yl)-2-propylbenzoic acid (PubChem CID 67659199) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-(6-methoxy-2-phenylmethoxynaphthalen-1-yl)-2-propylbenzoic acid.
| Compound Name | 3-(6-methoxy-2-phenylmethoxynaphthalen-1-yl)-2-propylbenzoic acid |
|---|---|
| PubChem CID | 67659199 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-(6-methoxy-2-phenylmethoxynaphthalen-1-yl)-2-propylbenzoic acid |
| SMILES | CCCc1c(C(=O)O)cccc1-c1c(OCc2ccccc2)ccc2cc(OC)ccc12 |
| InChI | InChI=1S/C28H26O4/c1-3-8-23-24(11-7-12-25(23)28(29)30)27-22-15-14-21(31-2)17-20(22)13-16-26(27)32-18-19-9-5-4-6-10-19/h4-7,9-17H,3,8,18H2,1-2H3,(H,29,30) |
| InChIKey | GRURFMDXFXWEPI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |