C24H27ClN4O4 — CID 67661129
[2-benzamido-6-[4-(pyrimidin-2-ylamino)butoxy]phenyl] propanoate;hydrochloride (PubChem CID 67661129) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is [2-benzamido-6-[4-(pyrimidin-2-ylamino)butoxy]phenyl] propanoate;hydrochloride.
| Compound Name | [2-benzamido-6-[4-(pyrimidin-2-ylamino)butoxy]phenyl] propanoate;hydrochloride |
|---|---|
| PubChem CID | 67661129 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [2-benzamido-6-[4-(pyrimidin-2-ylamino)butoxy]phenyl] propanoate;hydrochloride |
| SMILES | CCC(=O)Oc1c(NC(=O)c2ccccc2)cccc1OCCCCNc1ncccn1.Cl |
| InChI | InChI=1S/C24H26N4O4.ClH/c1-2-21(29)32-22-19(28-23(30)18-10-4-3-5-11-18)12-8-13-20(22)31-17-7-6-14-25-24-26-15-9-16-27-24;/h3-5,8-13,15-16H,2,6-7,14,17H2,1H3,(H,28,30)(H,25,26,27);1H |
| InChIKey | BHWJPESAJCZNKM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|