C22H30N2O5S — CID 175023085
[2-(butylsulfonylamino)-6-(4-pyridin-4-ylbutoxy)phenyl] propanoate (PubChem CID 175023085) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is [2-(butylsulfonylamino)-6-(4-pyridin-4-ylbutoxy)phenyl] propanoate.
| Compound Name | [2-(butylsulfonylamino)-6-(4-pyridin-4-ylbutoxy)phenyl] propanoate |
|---|---|
| PubChem CID | 175023085 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [2-(butylsulfonylamino)-6-(4-pyridin-4-ylbutoxy)phenyl] propanoate |
| SMILES | CCCCS(=O)(=O)Nc1cccc(OCCCCc2ccncc2)c1OC(=O)CC |
| InChI | InChI=1S/C22H30N2O5S/c1-3-5-17-30(26,27)24-19-10-8-11-20(22(19)29-21(25)4-2)28-16-7-6-9-18-12-14-23-15-13-18/h8,10-15,24H,3-7,9,16-17H2,1-2H3 |
| InChIKey | RNWDKIRBTPZGHU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|