C22H28O7S — CID 57006249
[2-ethoxy-6-[4-(3-methylsulfonyloxyphenyl)butoxy]phenyl] propanoate (PubChem CID 57006249) has the molecular formula C22H28O7S and a molecular weight of 436.53 g/mol. Its IUPAC name is [2-ethoxy-6-[4-(3-methylsulfonyloxyphenyl)butoxy]phenyl] propanoate.
| Compound Name | [2-ethoxy-6-[4-(3-methylsulfonyloxyphenyl)butoxy]phenyl] propanoate |
|---|---|
| PubChem CID | 57006249 |
| Molecular Formula | C22H28O7S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [2-ethoxy-6-[4-(3-methylsulfonyloxyphenyl)butoxy]phenyl] propanoate |
| SMILES | CCOc1cccc(OCCCCc2cccc(OS(C)(=O)=O)c2)c1OC(=O)CC |
| InChI | InChI=1S/C22H28O7S/c1-4-21(23)28-22-19(26-5-2)13-9-14-20(22)27-15-7-6-10-17-11-8-12-18(16-17)29-30(3,24)25/h8-9,11-14,16H,4-7,10,15H2,1-3H3 |
| InChIKey | FVCHOQIYAAWMND-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|