C27H44N2O7S — CID 70101524
tert-butyl 4-[4-[2-(butylsulfonylamino)-3-propanoyloxyphenoxy]butyl]piperidine-1-carboxylate (PubChem CID 70101524) has the molecular formula C27H44N2O7S and a molecular weight of 540.72 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(butylsulfonylamino)-3-propanoyloxyphenoxy]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(butylsulfonylamino)-3-propanoyloxyphenoxy]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70101524 |
| Molecular Formula | C27H44N2O7S |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | tert-butyl 4-[4-[2-(butylsulfonylamino)-3-propanoyloxyphenoxy]butyl]piperidine-1-carboxylate |
| SMILES | CCCCS(=O)(=O)Nc1c(OCCCCC2CCN(C(=O)OC(C)(C)C)CC2)cccc1OC(=O)CC |
| InChI | InChI=1S/C27H44N2O7S/c1-6-8-20-37(32,33)28-25-22(13-11-14-23(25)35-24(30)7-2)34-19-10-9-12-21-15-17-29(18-16-21)26(31)36-27(3,4)5/h11,13-14,21,28H,6-10,12,15-20H2,1-5H3 |
| InChIKey | PKVBHHKSLMRGAF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|