C19H20N4O3 — CID 67663268
6-(dimethylaminomethylidene)-9-[(4-nitrophenyl)methyl]-7,8-dihydropyrido[2,3-b]azepin-5-one (PubChem CID 67663268) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 6-(dimethylaminomethylidene)-9-[(4-nitrophenyl)methyl]-7,8-dihydropyrido[2,3-b]azepin-5-one.
| Compound Name | 6-(dimethylaminomethylidene)-9-[(4-nitrophenyl)methyl]-7,8-dihydropyrido[2,3-b]azepin-5-one |
|---|---|
| PubChem CID | 67663268 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 6-(dimethylaminomethylidene)-9-[(4-nitrophenyl)methyl]-7,8-dihydropyrido[2,3-b]azepin-5-one |
| SMILES | CN(C)C=C1CCN(Cc2ccc([N+](=O)[O-])cc2)c2ncccc2C1=O |
| InChI | InChI=1S/C19H20N4O3/c1-21(2)13-15-9-11-22(19-17(18(15)24)4-3-10-20-19)12-14-5-7-16(8-6-14)23(25)26/h3-8,10,13H,9,11-12H2,1-2H3 |
| InChIKey | KCSTZCVXNJCLSM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|