C13H19ClN4O — CID 67666152
(2S)-N-(4-carbamimidoylphenyl)-N-methylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 67666152) has the molecular formula C13H19ClN4O and a molecular weight of 282.78 g/mol. Its IUPAC name is (2S)-N-(4-carbamimidoylphenyl)-N-methylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-(4-carbamimidoylphenyl)-N-methylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67666152 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2S)-N-(4-carbamimidoylphenyl)-N-methylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N(C)C(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C13H18N4O.ClH/c1-17(13(18)11-3-2-8-16-11)10-6-4-9(5-7-10)12(14)15;/h4-7,11,16H,2-3,8H2,1H3,(H3,14,15);1H/t11-;/m0./s1 |
| InChIKey | QZJXYDAGINOUFW-MERQFXBCSA-N |
| XLogP | 1.11 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|