C24H38ClN5O4S — CID 67666800
(2S)-1-[4-[N-[(2S)-2-aminopropanoyl]-N'-ethylsulfonylcarbamimidoyl]-2-cyclohexylphenyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 67666800) has the molecular formula C24H38ClN5O4S and a molecular weight of 528.12 g/mol. Its IUPAC name is (2S)-1-[4-[N-[(2S)-2-aminopropanoyl]-N'-ethylsulfonylcarbamimidoyl]-2-cyclohexylphenyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-1-[4-[N-[(2S)-2-aminopropanoyl]-N'-ethylsulfonylcarbamimidoyl]-2-cyclohexylphenyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67666800 |
| Molecular Formula | C24H38ClN5O4S |
| Molecular Weight | 528.12 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | (2S)-1-[4-[N-[(2S)-2-aminopropanoyl]-N'-ethylsulfonylcarbamimidoyl]-2-cyclohexylphenyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CCS(=O)(=O)N=C(NC(=O)[C@H](C)N)c1ccc(N2CCC[C@H]2C(=O)NC)c(C2CCCCC2)c1.Cl |
| InChI | InChI=1S/C24H37N5O4S.ClH/c1-4-34(32,33)28-22(27-23(30)16(2)25)18-12-13-20(19(15-18)17-9-6-5-7-10-17)29-14-8-11-21(29)24(31)26-3;/h12-13,15-17,21H,4-11,14,25H2,1-3H3,(H,26,31)(H,27,28,30);1H/t16-,21-;/m0./s1 |
| InChIKey | SFJAGGOGAZHNPG-ZOEDVAEJSA-N |
| XLogP | 2.43 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|