C24H27BrF3NO3 — CID 67667603
tert-butyl 3-bromo-2-phenyl-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate (PubChem CID 67667603) has the molecular formula C24H27BrF3NO3 and a molecular weight of 514.38 g/mol. Its IUPAC name is tert-butyl 3-bromo-2-phenyl-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-2-phenyl-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67667603 |
| Molecular Formula | C24H27BrF3NO3 |
| Molecular Weight | 514.38 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | tert-butyl 3-bromo-2-phenyl-3-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Br)(OCc2cccc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C24H27BrF3NO3/c1-22(2,3)32-21(30)29-14-8-13-23(25,20(29)18-10-5-4-6-11-18)31-16-17-9-7-12-19(15-17)24(26,27)28/h4-7,9-12,15,20H,8,13-14,16H2,1-3H3 |
| InChIKey | BBOQYWVPYLIPRE-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.38 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|