C16H13F3N2O5 — CID 67667683
(Z)-3-methoxy-2-[4-methoxy-6-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 67667683) has the molecular formula C16H13F3N2O5 and a molecular weight of 370.28 g/mol. Its IUPAC name is (Z)-3-methoxy-2-[4-methoxy-6-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (Z)-3-methoxy-2-[4-methoxy-6-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67667683 |
| Molecular Formula | C16H13F3N2O5 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (Z)-3-methoxy-2-[4-methoxy-6-[3-(trifluoromethyl)phenoxy]pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | CO/C=C(\C(=O)O)c1c(OC)ncnc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N2O5/c1-24-7-11(15(22)23)12-13(25-2)20-8-21-14(12)26-10-5-3-4-9(6-10)16(17,18)19/h3-8H,1-2H3,(H,22,23)/b11-7- |
| InChIKey | QGHSOEPDOZIQJQ-XFFZJAGNSA-N |
| XLogP | 3.37 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|