C28H29FN2O3 — CID 67671232
3-ethyl-2-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(3-methoxyphenyl)benzamide (PubChem CID 67671232) has the molecular formula C28H29FN2O3 and a molecular weight of 460.55 g/mol. Its IUPAC name is 3-ethyl-2-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(3-methoxyphenyl)benzamide.
| Compound Name | 3-ethyl-2-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 67671232 |
| Molecular Formula | C28H29FN2O3 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-ethyl-2-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(3-methoxyphenyl)benzamide |
| SMILES | CCc1cccc(C(=O)Nc2cccc(OC)c2)c1N1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H29FN2O3/c1-3-19-6-4-9-25(28(33)30-23-7-5-8-24(18-23)34-2)26(19)31-16-14-21(15-17-31)27(32)20-10-12-22(29)13-11-20/h4-13,18,21H,3,14-17H2,1-2H3,(H,30,33) |
| InChIKey | YQHDGVUMVQFULK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |