C29H31FN2O4 — CID 67671432
N-(2,4-dimethoxyphenyl)-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]benzamide (PubChem CID 67671432) has the molecular formula C29H31FN2O4 and a molecular weight of 490.58 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 67671432 |
| Molecular Formula | C29H31FN2O4 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]benzamide |
| SMILES | CCc1c(C(=O)Nc2ccc(OC)cc2OC)cccc1N1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H31FN2O4/c1-4-23-24(29(34)31-25-13-12-22(35-2)18-27(25)36-3)6-5-7-26(23)32-16-14-20(15-17-32)28(33)19-8-10-21(30)11-9-19/h5-13,18,20H,4,14-17H2,1-3H3,(H,31,34) |
| InChIKey | PEKTZDTXNZAYFC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |