C37H34FN3O5 — CID 22357053
4-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(2-methoxyphenyl)benzamide (PubChem CID 22357053) has the molecular formula C37H34FN3O5 and a molecular weight of 619.69 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 22357053 |
| Molecular Formula | C37H34FN3O5 |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethyl-3-[4-(4-fluorobenzoyl)piperidin-1-yl]-N-(2-methoxyphenyl)benzamide |
| SMILES | CCc1c(C(=O)Nc2ccccc2OC)ccc(CN2C(=O)c3ccccc3C2=O)c1N1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C37H34FN3O5/c1-3-27-28(35(43)39-31-10-6-7-11-32(31)46-2)17-14-25(22-41-36(44)29-8-4-5-9-30(29)37(41)45)33(27)40-20-18-24(19-21-40)34(42)23-12-15-26(38)16-13-23/h4-17,24H,3,18-22H2,1-2H3,(H,39,43) |
| InChIKey | VVYPVRMQWDRPQE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|