C21H39F3N2O5 — CID 67672346
2-amino-N-[(1S,2S,6R)-2-methoxy-3,3-dimethyl-6-octoxycyclohexyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 67672346) has the molecular formula C21H39F3N2O5 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-amino-N-[(1S,2S,6R)-2-methoxy-3,3-dimethyl-6-octoxycyclohexyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-N-[(1S,2S,6R)-2-methoxy-3,3-dimethyl-6-octoxycyclohexyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67672346 |
| Molecular Formula | C21H39F3N2O5 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 2-amino-N-[(1S,2S,6R)-2-methoxy-3,3-dimethyl-6-octoxycyclohexyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCO[C@@H]1CCC(C)(C)[C@H](OC)[C@H]1NC(=O)CN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H38N2O3.C2HF3O2/c1-5-6-7-8-9-10-13-24-15-11-12-19(2,3)18(23-4)17(15)21-16(22)14-20;3-2(4,5)1(6)7/h15,17-18H,5-14,20H2,1-4H3,(H,21,22);(H,6,7)/t15-,17+,18-;/m1./s1 |
| InChIKey | VGKRSCAFOHVNIT-VMJXPXJZSA-N |
| XLogP | 3.64 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|