C19H36O3 — CID 19699689
1-(2-methoxy-3,3-dimethyl-6-octoxycyclohexyl)ethanone (PubChem CID 19699689) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 1-(2-methoxy-3,3-dimethyl-6-octoxycyclohexyl)ethanone.
| Compound Name | 1-(2-methoxy-3,3-dimethyl-6-octoxycyclohexyl)ethanone |
|---|---|
| PubChem CID | 19699689 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | 1-(2-methoxy-3,3-dimethyl-6-octoxycyclohexyl)ethanone |
| SMILES | CCCCCCCCOC1CCC(C)(C)C(OC)C1C(C)=O |
| InChI | InChI=1S/C19H36O3/c1-6-7-8-9-10-11-14-22-16-12-13-19(3,4)18(21-5)17(16)15(2)20/h16-18H,6-14H2,1-5H3 |
| InChIKey | HOCXCRSQMLTMGA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|